C21H25F2N3O4S — CID 30669790
N-[3-[4-[butyl(methyl)sulfamoyl]anilino]-3-oxopropyl]-2,4-difluorobenzamide (PubChem CID 30669790) has the molecular formula C21H25F2N3O4S and a molecular weight of 453.51 g/mol. Its IUPAC name is N-[3-[4-[butyl(methyl)sulfamoyl]anilino]-3-oxopropyl]-2,4-difluorobenzamide.
| Compound Name | N-[3-[4-[butyl(methyl)sulfamoyl]anilino]-3-oxopropyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 30669790 |
| Molecular Formula | C21H25F2N3O4S |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | N-[3-[4-[butyl(methyl)sulfamoyl]anilino]-3-oxopropyl]-2,4-difluorobenzamide |
| SMILES | CCCCN(C)S(=O)(=O)c1ccc(NC(=O)CCNC(=O)c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C21H25F2N3O4S/c1-3-4-13-26(2)31(29,30)17-8-6-16(7-9-17)25-20(27)11-12-24-21(28)18-10-5-15(22)14-19(18)23/h5-10,14H,3-4,11-13H2,1-2H3,(H,24,28)(H,25,27) |
| InChIKey | HAQRPXZHQPIODH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |