C12H14BrClFNO3S — CID 65368998
2-bromo-5-fluoro-3-(pentylcarbamoyl)benzenesulfonyl chloride (PubChem CID 65368998) has the molecular formula C12H14BrClFNO3S and a molecular weight of 386.67 g/mol. Its IUPAC name is 2-bromo-5-fluoro-3-(pentylcarbamoyl)benzenesulfonyl chloride.
| Compound Name | 2-bromo-5-fluoro-3-(pentylcarbamoyl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 65368998 |
| Molecular Formula | C12H14BrClFNO3S |
| Molecular Weight | 386.67 g/mol |
| Exact Mass | 384.96 |
| IUPAC Name | 2-bromo-5-fluoro-3-(pentylcarbamoyl)benzenesulfonyl chloride |
| SMILES | CCCCCNC(=O)c1cc(F)cc(S(=O)(=O)Cl)c1Br |
| InChI | InChI=1S/C12H14BrClFNO3S/c1-2-3-4-5-16-12(17)9-6-8(15)7-10(11(9)13)20(14,18)19/h6-7H,2-5H2,1H3,(H,16,17) |
| InChIKey | HFMPPKWAQAWFJO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.67 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|