C25H23NO5S2 — CID 70430590
2-(butylcarbamoyl)-6-(2-carboxyphenyl)sulfanyl-4-phenylsulfanylbenzoic acid (PubChem CID 70430590) has the molecular formula C25H23NO5S2 and a molecular weight of 481.60 g/mol. Its IUPAC name is 2-(butylcarbamoyl)-6-(2-carboxyphenyl)sulfanyl-4-phenylsulfanylbenzoic acid.
| Compound Name | 2-(butylcarbamoyl)-6-(2-carboxyphenyl)sulfanyl-4-phenylsulfanylbenzoic acid |
|---|---|
| PubChem CID | 70430590 |
| Molecular Formula | C25H23NO5S2 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | 2-(butylcarbamoyl)-6-(2-carboxyphenyl)sulfanyl-4-phenylsulfanylbenzoic acid |
| SMILES | CCCCNC(=O)c1cc(Sc2ccccc2)cc(Sc2ccccc2C(=O)O)c1C(=O)O |
| InChI | InChI=1S/C25H23NO5S2/c1-2-3-13-26-23(27)19-14-17(32-16-9-5-4-6-10-16)15-21(22(19)25(30)31)33-20-12-8-7-11-18(20)24(28)29/h4-12,14-15H,2-3,13H2,1H3,(H,26,27)(H,28,29)(H,30,31) |
| InChIKey | AOBTYOWWVWYCSK-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|