C21H26N2OS2 — CID 126714257
2-sulfanyl-N-[6-[1-(2-sulfanylphenyl)ethenylamino]hexyl]benzamide (PubChem CID 126714257) has the molecular formula C21H26N2OS2 and a molecular weight of 386.59 g/mol. Its IUPAC name is 2-sulfanyl-N-[6-[1-(2-sulfanylphenyl)ethenylamino]hexyl]benzamide.
| Compound Name | 2-sulfanyl-N-[6-[1-(2-sulfanylphenyl)ethenylamino]hexyl]benzamide |
|---|---|
| PubChem CID | 126714257 |
| Molecular Formula | C21H26N2OS2 |
| Molecular Weight | 386.59 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 2-sulfanyl-N-[6-[1-(2-sulfanylphenyl)ethenylamino]hexyl]benzamide |
| SMILES | C=C(NCCCCCCNC(=O)c1ccccc1S)c1ccccc1S |
| InChI | InChI=1S/C21H26N2OS2/c1-16(17-10-4-6-12-19(17)25)22-14-8-2-3-9-15-23-21(24)18-11-5-7-13-20(18)26/h4-7,10-13,22,25-26H,1-3,8-9,14-15H2,(H,23,24) |
| InChIKey | JDCJKLAEEVOBHF-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.59 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|