C20H29N3S — CID 126714253
2-[1-[5-[[(3E,5Z)-6-amino-3-methylhexa-1,3,5-trien-2-yl]amino]pentylamino]ethenyl]benzenethiol (PubChem CID 126714253) has the molecular formula C20H29N3S and a molecular weight of 343.54 g/mol. Its IUPAC name is 2-[1-[5-[[(3E,5Z)-6-amino-3-methylhexa-1,3,5-trien-2-yl]amino]pentylamino]ethenyl]benzenethiol.
| Compound Name | 2-[1-[5-[[(3E,5Z)-6-amino-3-methylhexa-1,3,5-trien-2-yl]amino]pentylamino]ethenyl]benzenethiol |
|---|---|
| PubChem CID | 126714253 |
| Molecular Formula | C20H29N3S |
| Molecular Weight | 343.54 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 2-[1-[5-[[(3E,5Z)-6-amino-3-methylhexa-1,3,5-trien-2-yl]amino]pentylamino]ethenyl]benzenethiol |
| SMILES | C=C(NCCCCCNC(=C)c1ccccc1S)/C(C)=C/C=C\N |
| InChI | InChI=1S/C20H29N3S/c1-16(10-9-13-21)17(2)22-14-7-4-8-15-23-18(3)19-11-5-6-12-20(19)24/h5-6,9-13,22-24H,2-4,7-8,14-15,21H2,1H3/b13-9-,16-10+ |
| InChIKey | ZMPSRTJIAICWMK-XMHXKSDUSA-N |
| XLogP | 4.23 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.54 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|