C14H19BrN4O3 — CID 9037779
[6-[2-(2-bromobenzoyl)hydrazinyl]-6-oxohexyl]urea (PubChem CID 9037779) has the molecular formula C14H19BrN4O3 and a molecular weight of 371.24 g/mol. Its IUPAC name is [6-[2-(2-bromobenzoyl)hydrazinyl]-6-oxohexyl]urea.
| Compound Name | [6-[2-(2-bromobenzoyl)hydrazinyl]-6-oxohexyl]urea |
|---|---|
| PubChem CID | 9037779 |
| Molecular Formula | C14H19BrN4O3 |
| Molecular Weight | 371.24 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | [6-[2-(2-bromobenzoyl)hydrazinyl]-6-oxohexyl]urea |
| SMILES | NC(=O)NCCCCCC(=O)NNC(=O)c1ccccc1Br |
| InChI | InChI=1S/C14H19BrN4O3/c15-11-7-4-3-6-10(11)13(21)19-18-12(20)8-2-1-5-9-17-14(16)22/h3-4,6-7H,1-2,5,8-9H2,(H,18,20)(H,19,21)(H3,16,17,22) |
| InChIKey | YATDUKGPMWBFAQ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.24 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|