C24H24FN3O3 — CID 10502272
2-fluoro-N-[6-[2-(naphthalene-1-carbonyl)hydrazinyl]-6-oxohexyl]benzamide (PubChem CID 10502272) has the molecular formula C24H24FN3O3 and a molecular weight of 421.47 g/mol. Its IUPAC name is 2-fluoro-N-[6-[2-(naphthalene-1-carbonyl)hydrazinyl]-6-oxohexyl]benzamide.
| Compound Name | 2-fluoro-N-[6-[2-(naphthalene-1-carbonyl)hydrazinyl]-6-oxohexyl]benzamide |
|---|---|
| PubChem CID | 10502272 |
| Molecular Formula | C24H24FN3O3 |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 2-fluoro-N-[6-[2-(naphthalene-1-carbonyl)hydrazinyl]-6-oxohexyl]benzamide |
| SMILES | O=C(CCCCCNC(=O)c1ccccc1F)NNC(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C24H24FN3O3/c25-21-14-6-5-12-20(21)23(30)26-16-7-1-2-15-22(29)27-28-24(31)19-13-8-10-17-9-3-4-11-18(17)19/h3-6,8-14H,1-2,7,15-16H2,(H,26,30)(H,27,29)(H,28,31) |
| InChIKey | BPJAGRUMVCUXNT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|