C20H20I2N4O4 — CID 3752401
1-N',6-N'-bis(2-iodobenzoyl)hexanedihydrazide (PubChem CID 3752401) has the molecular formula C20H20I2N4O4 and a molecular weight of 634.21 g/mol. Its IUPAC name is 1-N',6-N'-bis(2-iodobenzoyl)hexanedihydrazide.
| Compound Name | 1-N',6-N'-bis(2-iodobenzoyl)hexanedihydrazide |
|---|---|
| PubChem CID | 3752401 |
| Molecular Formula | C20H20I2N4O4 |
| Molecular Weight | 634.21 g/mol |
| Exact Mass | 633.96 |
| IUPAC Name | 1-N',6-N'-bis(2-iodobenzoyl)hexanedihydrazide |
| SMILES | O=C(CCCCC(=O)NNC(=O)c1ccccc1I)NNC(=O)c1ccccc1I |
| InChI | InChI=1S/C20H20I2N4O4/c21-15-9-3-1-7-13(15)19(29)25-23-17(27)11-5-6-12-18(28)24-26-20(30)14-8-2-4-10-16(14)22/h1-4,7-10H,5-6,11-12H2,(H,23,27)(H,24,28)(H,25,29)(H,26,30) |
| InChIKey | IZSDIRUWVNVHSQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.21 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|