About 2-bromo-N'-[3-(3,4-dimethylphenyl)sulfanylpropanoyl]benzohydrazide
2-bromo-N'-[3-(3,4-dimethylphenyl)sulfanylpropanoyl]benzohydrazide (PubChem CID 8573739) has the molecular formula C18H19BrN2O2S
and a molecular weight of 407.33 g/mol. Its IUPAC name is 2-bromo-N'-[3-(3,4-dimethylphenyl)sulfanylpropanoyl]benzohydrazide.
Molecular Properties
| Compound Name | 2-bromo-N'-[3-(3,4-dimethylphenyl)sulfanylpropanoyl]benzohydrazide |
| PubChem CID | 8573739 |
| Molecular Formula | C18H19BrN2O2S |
| Molecular Weight | 407.33 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | 2-bromo-N'-[3-(3,4-dimethylphenyl)sulfanylpropanoyl]benzohydrazide |
| SMILES | Cc1ccc(SCCC(=O)NNC(=O)c2ccccc2Br)cc1C |
| InChI | InChI=1S/C18H19BrN2O2S/c1-12-7-8-14(11-13(12)2)24-10-9-17(22)20-21-18(23)15-5-3-4-6-16(15)19/h3-8,11H,9-10H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | XRZSYONXUYOUEZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.33 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-N'-[3-(3,4-dimethylphenyl)sulfanylpropanoyl]benzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N'-[3-(3,4-dimethylphenyl)sulfanylpropanoyl]benzohydrazide?
The IUPAC name of 2-bromo-N'-[3-(3,4-dimethylphenyl)sulfanylpropanoyl]benzohydrazide (CID 8573739) is 2-bromo-N'-[3-(3,4-dimethylphenyl)sulfanylpropanoyl]benzohydrazide.
What is the SMILES notation for 2-bromo-N'-[3-(3,4-dimethylphenyl)sulfanylpropanoyl]benzohydrazide?
The canonical SMILES for 2-bromo-N'-[3-(3,4-dimethylphenyl)sulfanylpropanoyl]benzohydrazide is Cc1ccc(SCCC(=O)NNC(=O)c2ccccc2Br)cc1C.
What is the InChIKey of 2-bromo-N'-[3-(3,4-dimethylphenyl)sulfanylpropanoyl]benzohydrazide?
The InChIKey is XRZSYONXUYOUEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19BrN2O2S/c1-12-7-8-14(11-13(12)2)24-10-9-17(22)20-21-18(23)15-5-3-4-6-16(15)19/h3-8,11H,9-10H2,1-2H3,(H,20,22)(H,21,23).
What are the key properties of 2-bromo-N'-[3-(3,4-dimethylphenyl)sulfanylpropanoyl]benzohydrazide?
2-bromo-N'-[3-(3,4-dimethylphenyl)sulfanylpropanoyl]benzohydrazide has a molecular weight of 407.33 g/mol, XLogP of 4.01, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N'-[3-(3,4-dimethylphenyl)sulfanylpropanoyl]benzohydrazide is sourced from PubChem (CID 8573739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).