C37H43N5O4S2 — CID 144697898
N-(6-anilino-6-oxohexyl)-2-sulfanylbenzamide;N-[6-oxo-6-(pyridin-3-ylamino)hexyl]-2-sulfanylbenzamide (PubChem CID 144697898) has the molecular formula C37H43N5O4S2 and a molecular weight of 685.92 g/mol. Its IUPAC name is N-(6-anilino-6-oxohexyl)-2-sulfanylbenzamide;N-[6-oxo-6-(pyridin-3-ylamino)hexyl]-2-sulfanylbenzamide.
| Compound Name | N-(6-anilino-6-oxohexyl)-2-sulfanylbenzamide;N-[6-oxo-6-(pyridin-3-ylamino)hexyl]-2-sulfanylbenzamide |
|---|---|
| PubChem CID | 144697898 |
| Molecular Formula | C37H43N5O4S2 |
| Molecular Weight | 685.92 g/mol |
| Exact Mass | 685.28 |
| IUPAC Name | N-(6-anilino-6-oxohexyl)-2-sulfanylbenzamide;N-[6-oxo-6-(pyridin-3-ylamino)hexyl]-2-sulfanylbenzamide |
| SMILES | O=C(CCCCCNC(=O)c1ccccc1S)Nc1ccccc1.O=C(CCCCCNC(=O)c1ccccc1S)Nc1cccnc1 |
| InChI | InChI=1S/C19H22N2O2S.C18H21N3O2S/c22-18(21-15-9-3-1-4-10-15)13-5-2-8-14-20-19(23)16-11-6-7-12-17(16)24;22-17(21-14-7-6-11-19-13-14)10-2-1-5-12-20-18(23)15-8-3-4-9-16(15)24/h1,3-4,6-7,9-12,24H,2,5,8,13-14H2,(H,20,23)(H,21,22);3-4,6-9,11,13,24H,1-2,5,10,12H2,(H,20,23)(H,21,22) |
| InChIKey | DMXHRSGIYJXAPG-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 129.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.92 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|