C27H29N5O5 — CID 91608012
2-amino-N-[2-[hydroxy(pyridine-3-carbonyl)carbamoyl]phenyl]-N'-phenyloctanediamide (PubChem CID 91608012) has the molecular formula C27H29N5O5 and a molecular weight of 503.56 g/mol. Its IUPAC name is 2-amino-N-[2-[hydroxy(pyridine-3-carbonyl)carbamoyl]phenyl]-N'-phenyloctanediamide.
| Compound Name | 2-amino-N-[2-[hydroxy(pyridine-3-carbonyl)carbamoyl]phenyl]-N'-phenyloctanediamide |
|---|---|
| PubChem CID | 91608012 |
| Molecular Formula | C27H29N5O5 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | 2-amino-N-[2-[hydroxy(pyridine-3-carbonyl)carbamoyl]phenyl]-N'-phenyloctanediamide |
| SMILES | NC(CCCCCC(=O)Nc1ccccc1)C(=O)Nc1ccccc1C(=O)N(O)C(=O)c1cccnc1 |
| InChI | InChI=1S/C27H29N5O5/c28-22(14-5-2-6-16-24(33)30-20-11-3-1-4-12-20)25(34)31-23-15-8-7-13-21(23)27(36)32(37)26(35)19-10-9-17-29-18-19/h1,3-4,7-13,15,17-18,22,37H,2,5-6,14,16,28H2,(H,30,33)(H,31,34) |
| InChIKey | VLOBSIDRYIHESN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 154.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|