C12H18N2S — CID 170637431
3-[1-(pentylamino)ethenyl]-1H-pyridine-2-thione (PubChem CID 170637431) has the molecular formula C12H18N2S and a molecular weight of 222.36 g/mol. Its IUPAC name is 3-[1-(pentylamino)ethenyl]-1H-pyridine-2-thione.
| Compound Name | 3-[1-(pentylamino)ethenyl]-1H-pyridine-2-thione |
|---|---|
| PubChem CID | 170637431 |
| Molecular Formula | C12H18N2S |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 3-[1-(pentylamino)ethenyl]-1H-pyridine-2-thione |
| SMILES | C=C(NCCCCC)c1ccc[nH]c1=S |
| InChI | InChI=1S/C12H18N2S/c1-3-4-5-8-13-10(2)11-7-6-9-14-12(11)15/h6-7,9,13H,2-5,8H2,1H3,(H,14,15) |
| InChIKey | XVFOHAARRSGJPE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|