C8H9NOS — CID 77228632
1-(2-sulfanylidene-1H-pyridin-3-yl)propan-1-one (PubChem CID 77228632) has the molecular formula C8H9NOS and a molecular weight of 167.23 g/mol. Its IUPAC name is 1-(2-sulfanylidene-1H-pyridin-3-yl)propan-1-one.
| Compound Name | 1-(2-sulfanylidene-1H-pyridin-3-yl)propan-1-one |
|---|---|
| PubChem CID | 77228632 |
| Molecular Formula | C8H9NOS |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.04 |
| IUPAC Name | 1-(2-sulfanylidene-1H-pyridin-3-yl)propan-1-one |
| SMILES | CCC(=O)c1ccc[nH]c1=S |
| InChI | InChI=1S/C8H9NOS/c1-2-7(10)6-4-3-5-9-8(6)11/h3-5H,2H2,1H3,(H,9,11) |
| InChIKey | JDYQHNOXRVXMNP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|