C8H11NO2S — CID 91103055
ethane;2-sulfanylidene-1H-pyridine-3-carboxylic acid (PubChem CID 91103055) has the molecular formula C8H11NO2S and a molecular weight of 185.25 g/mol. Its IUPAC name is ethane;2-sulfanylidene-1H-pyridine-3-carboxylic acid.
| Compound Name | ethane;2-sulfanylidene-1H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 91103055 |
| Molecular Formula | C8H11NO2S |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.05 |
| IUPAC Name | ethane;2-sulfanylidene-1H-pyridine-3-carboxylic acid |
| SMILES | CC.O=C(O)c1ccc[nH]c1=S |
| InChI | InChI=1S/C6H5NO2S.C2H6/c8-6(9)4-2-1-3-7-5(4)10;1-2/h1-3H,(H,7,10)(H,8,9);1-2H3 |
| InChIKey | YVAJCAWRCSUTTH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|