C11H14N2O3S — CID 88537650
ethyl (2S)-2-[(2-sulfanylidene-1H-pyridine-3-carbonyl)amino]propanoate (PubChem CID 88537650) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is ethyl (2S)-2-[(2-sulfanylidene-1H-pyridine-3-carbonyl)amino]propanoate.
| Compound Name | ethyl (2S)-2-[(2-sulfanylidene-1H-pyridine-3-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 88537650 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | ethyl (2S)-2-[(2-sulfanylidene-1H-pyridine-3-carbonyl)amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NC(=O)c1ccc[nH]c1=S |
| InChI | InChI=1S/C11H14N2O3S/c1-3-16-11(15)7(2)13-9(14)8-5-4-6-12-10(8)17/h4-7H,3H2,1-2H3,(H,12,17)(H,13,14)/t7-/m0/s1 |
| InChIKey | JEPSDICWUJAMQV-ZETCQYMHSA-N |
| XLogP | 1.43 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|