C13H18N2O3S — CID 102560844
ethyl 4-[(2-sulfanylidene-1H-pyridine-3-carbonyl)amino]pentanoate (PubChem CID 102560844) has the molecular formula C13H18N2O3S and a molecular weight of 282.36 g/mol. Its IUPAC name is ethyl 4-[(2-sulfanylidene-1H-pyridine-3-carbonyl)amino]pentanoate.
| Compound Name | ethyl 4-[(2-sulfanylidene-1H-pyridine-3-carbonyl)amino]pentanoate |
|---|---|
| PubChem CID | 102560844 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | ethyl 4-[(2-sulfanylidene-1H-pyridine-3-carbonyl)amino]pentanoate |
| SMILES | CCOC(=O)CCC(C)NC(=O)c1ccc[nH]c1=S |
| InChI | InChI=1S/C13H18N2O3S/c1-3-18-11(16)7-6-9(2)15-12(17)10-5-4-8-14-13(10)19/h4-5,8-9H,3,6-7H2,1-2H3,(H,14,19)(H,15,17) |
| InChIKey | XWIXJSULNWWXFH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|