C11H17N3O4S — CID 60686825
N'-[2-[bis(2-hydroxyethyl)amino]acetyl]thiophene-2-carbohydrazide (PubChem CID 60686825) has the molecular formula C11H17N3O4S and a molecular weight of 287.34 g/mol. Its IUPAC name is N'-[2-[bis(2-hydroxyethyl)amino]acetyl]thiophene-2-carbohydrazide.
| Compound Name | N'-[2-[bis(2-hydroxyethyl)amino]acetyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 60686825 |
| Molecular Formula | C11H17N3O4S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | N'-[2-[bis(2-hydroxyethyl)amino]acetyl]thiophene-2-carbohydrazide |
| SMILES | O=C(CN(CCO)CCO)NNC(=O)c1cccs1 |
| InChI | InChI=1S/C11H17N3O4S/c15-5-3-14(4-6-16)8-10(17)12-13-11(18)9-2-1-7-19-9/h1-2,7,15-16H,3-6,8H2,(H,12,17)(H,13,18) |
| InChIKey | IFLFPNBUJRNJPK-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|