C14H24N4O2S — CID 115317749
N'-[2-[(3-amino-4-methylpentyl)-methylamino]acetyl]thiophene-2-carbohydrazide (PubChem CID 115317749) has the molecular formula C14H24N4O2S and a molecular weight of 312.44 g/mol. Its IUPAC name is N'-[2-[(3-amino-4-methylpentyl)-methylamino]acetyl]thiophene-2-carbohydrazide.
| Compound Name | N'-[2-[(3-amino-4-methylpentyl)-methylamino]acetyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 115317749 |
| Molecular Formula | C14H24N4O2S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | N'-[2-[(3-amino-4-methylpentyl)-methylamino]acetyl]thiophene-2-carbohydrazide |
| SMILES | CC(C)C(N)CCN(C)CC(=O)NNC(=O)c1cccs1 |
| InChI | InChI=1S/C14H24N4O2S/c1-10(2)11(15)6-7-18(3)9-13(19)16-17-14(20)12-5-4-8-21-12/h4-5,8,10-11H,6-7,9,15H2,1-3H3,(H,16,19)(H,17,20) |
| InChIKey | KGDMTZQLKNGZOG-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|