About (2-phenyl-1,3-oxazol-4-yl)methyl 2-methylfuran-3-carboxylate
(2-phenyl-1,3-oxazol-4-yl)methyl 2-methylfuran-3-carboxylate (PubChem CID 18197445) has the molecular formula C16H13NO4
and a molecular weight of 283.28 g/mol. Its IUPAC name is (2-phenyl-1,3-oxazol-4-yl)methyl 2-methylfuran-3-carboxylate.
Analyze (2-phenyl-1,3-oxazol-4-yl)methyl 2-methylfuran-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-phenyl-1,3-oxazol-4-yl)methyl 2-methylfuran-3-carboxylate?
The IUPAC name of (2-phenyl-1,3-oxazol-4-yl)methyl 2-methylfuran-3-carboxylate (CID 18197445) is (2-phenyl-1,3-oxazol-4-yl)methyl 2-methylfuran-3-carboxylate.
What is the SMILES notation for (2-phenyl-1,3-oxazol-4-yl)methyl 2-methylfuran-3-carboxylate?
The canonical SMILES for (2-phenyl-1,3-oxazol-4-yl)methyl 2-methylfuran-3-carboxylate is Cc1occc1C(=O)OCc1coc(-c2ccccc2)n1.
What is the InChIKey of (2-phenyl-1,3-oxazol-4-yl)methyl 2-methylfuran-3-carboxylate?
The InChIKey is MZCBFZKVBHMHMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO4/c1-11-14(7-8-19-11)16(18)21-10-13-9-20-15(17-13)12-5-3-2-4-6-12/h2-9H,10H2,1H3.
What are the key properties of (2-phenyl-1,3-oxazol-4-yl)methyl 2-methylfuran-3-carboxylate?
(2-phenyl-1,3-oxazol-4-yl)methyl 2-methylfuran-3-carboxylate has a molecular weight of 283.28 g/mol, XLogP of 3.60, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-phenyl-1,3-oxazol-4-yl)methyl 2-methylfuran-3-carboxylate is sourced from PubChem (CID 18197445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).