C18H14ClNO5S — CID 18085109
(2-phenyl-1,3-oxazol-4-yl)methyl 2-chloro-5-methylsulfonylbenzoate (PubChem CID 18085109) has the molecular formula C18H14ClNO5S and a molecular weight of 391.83 g/mol. Its IUPAC name is (2-phenyl-1,3-oxazol-4-yl)methyl 2-chloro-5-methylsulfonylbenzoate.
| Compound Name | (2-phenyl-1,3-oxazol-4-yl)methyl 2-chloro-5-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 18085109 |
| Molecular Formula | C18H14ClNO5S |
| Molecular Weight | 391.83 g/mol |
| Exact Mass | 391.03 |
| IUPAC Name | (2-phenyl-1,3-oxazol-4-yl)methyl 2-chloro-5-methylsulfonylbenzoate |
| SMILES | CS(=O)(=O)c1ccc(Cl)c(C(=O)OCc2coc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C18H14ClNO5S/c1-26(22,23)14-7-8-16(19)15(9-14)18(21)25-11-13-10-24-17(20-13)12-5-3-2-4-6-12/h2-10H,11H2,1H3 |
| InChIKey | PGACRGHUXXYXCJ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 86.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.83 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |