C21H21ClN2O5S — CID 31710711
(2-phenyl-1,3-oxazol-4-yl)methyl 2-chloro-5-(diethylsulfamoyl)benzoate (PubChem CID 31710711) has the molecular formula C21H21ClN2O5S and a molecular weight of 448.93 g/mol. Its IUPAC name is (2-phenyl-1,3-oxazol-4-yl)methyl 2-chloro-5-(diethylsulfamoyl)benzoate.
| Compound Name | (2-phenyl-1,3-oxazol-4-yl)methyl 2-chloro-5-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 31710711 |
| Molecular Formula | C21H21ClN2O5S |
| Molecular Weight | 448.93 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | (2-phenyl-1,3-oxazol-4-yl)methyl 2-chloro-5-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Cl)c(C(=O)OCc2coc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C21H21ClN2O5S/c1-3-24(4-2)30(26,27)17-10-11-19(22)18(12-17)21(25)29-14-16-13-28-20(23-16)15-8-6-5-7-9-15/h5-13H,3-4,14H2,1-2H3 |
| InChIKey | BXRUQMOOVUJXGY-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 89.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.93 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |