C21H16N2O3 — CID 16508797
(2-phenyl-1,3-oxazol-4-yl)methyl 2-methylquinoline-4-carboxylate (PubChem CID 16508797) has the molecular formula C21H16N2O3 and a molecular weight of 344.37 g/mol. Its IUPAC name is (2-phenyl-1,3-oxazol-4-yl)methyl 2-methylquinoline-4-carboxylate.
| Compound Name | (2-phenyl-1,3-oxazol-4-yl)methyl 2-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 16508797 |
| Molecular Formula | C21H16N2O3 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | (2-phenyl-1,3-oxazol-4-yl)methyl 2-methylquinoline-4-carboxylate |
| SMILES | Cc1cc(C(=O)OCc2coc(-c3ccccc3)n2)c2ccccc2n1 |
| InChI | InChI=1S/C21H16N2O3/c1-14-11-18(17-9-5-6-10-19(17)22-14)21(24)26-13-16-12-25-20(23-16)15-7-3-2-4-8-15/h2-12H,13H2,1H3 |
| InChIKey | QIWABQAQINPUJE-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |