(2-phenyl-1,3-oxazol-4-yl)methyl 2-bromo-5-methoxybenzoate

C18H14BrNO4 — CID 18085087

IUPAC(2-phenyl-1,3-oxazol-4-yl)methyl 2-bromo-5-methoxybenzoate
SMILESCOc1ccc(Br)c(C(=O)OCc2coc(-c3ccccc3)n2)c1
InChIInChI=1S/C18H14BrNO4/c1-22-14-7-8-16(19)15(9-14)18(21)24-11-13-10-23-17(20-13)12-5-3-2-4-6-12/h2-10H,11H2,1H3
InChIKeyWLTDLQHTVWJZOK-UHFFFAOYSA-N
MW388.22 g/mol
LogP4.47
Rot. Bonds5

About (2-phenyl-1,3-oxazol-4-yl)methyl 2-bromo-5-methoxybenzoate

(2-phenyl-1,3-oxazol-4-yl)methyl 2-bromo-5-methoxybenzoate (PubChem CID 18085087) has the molecular formula C18H14BrNO4 and a molecular weight of 388.22 g/mol. Its IUPAC name is (2-phenyl-1,3-oxazol-4-yl)methyl 2-bromo-5-methoxybenzoate.

Molecular Properties

Compound Name(2-phenyl-1,3-oxazol-4-yl)methyl 2-bromo-5-methoxybenzoate
PubChem CID18085087
Molecular FormulaC18H14BrNO4
Molecular Weight388.22 g/mol
Exact Mass387.01
IUPAC Name(2-phenyl-1,3-oxazol-4-yl)methyl 2-bromo-5-methoxybenzoate
SMILESCOc1ccc(Br)c(C(=O)OCc2coc(-c3ccccc3)n2)c1
InChIInChI=1S/C18H14BrNO4/c1-22-14-7-8-16(19)15(9-14)18(21)24-11-13-10-23-17(20-13)12-5-3-2-4-6-12/h2-10H,11H2,1H3
InChIKeyWLTDLQHTVWJZOK-UHFFFAOYSA-N
XLogP4.47
TPSA61.56 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500388.22
LogP ≤ 54.47
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze (2-phenyl-1,3-oxazol-4-yl)methyl 2-bromo-5-methoxybenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-phenyl-1,3-oxazol-4-yl)methyl 2-bromo-5-methoxybenzoate?
The IUPAC name of (2-phenyl-1,3-oxazol-4-yl)methyl 2-bromo-5-methoxybenzoate (CID 18085087) is (2-phenyl-1,3-oxazol-4-yl)methyl 2-bromo-5-methoxybenzoate.
What is the SMILES notation for (2-phenyl-1,3-oxazol-4-yl)methyl 2-bromo-5-methoxybenzoate?
The canonical SMILES for (2-phenyl-1,3-oxazol-4-yl)methyl 2-bromo-5-methoxybenzoate is COc1ccc(Br)c(C(=O)OCc2coc(-c3ccccc3)n2)c1.
What is the InChIKey of (2-phenyl-1,3-oxazol-4-yl)methyl 2-bromo-5-methoxybenzoate?
The InChIKey is WLTDLQHTVWJZOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14BrNO4/c1-22-14-7-8-16(19)15(9-14)18(21)24-11-13-10-23-17(20-13)12-5-3-2-4-6-12/h2-10H,11H2,1H3.
What are the key properties of (2-phenyl-1,3-oxazol-4-yl)methyl 2-bromo-5-methoxybenzoate?
(2-phenyl-1,3-oxazol-4-yl)methyl 2-bromo-5-methoxybenzoate has a molecular weight of 388.22 g/mol, XLogP of 4.47, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-phenyl-1,3-oxazol-4-yl)methyl 2-bromo-5-methoxybenzoate is sourced from PubChem (CID 18085087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).