C18H14BrNO4 — CID 18085087
(2-phenyl-1,3-oxazol-4-yl)methyl 2-bromo-5-methoxybenzoate (PubChem CID 18085087) has the molecular formula C18H14BrNO4 and a molecular weight of 388.22 g/mol. Its IUPAC name is (2-phenyl-1,3-oxazol-4-yl)methyl 2-bromo-5-methoxybenzoate.
| Compound Name | (2-phenyl-1,3-oxazol-4-yl)methyl 2-bromo-5-methoxybenzoate |
|---|---|
| PubChem CID | 18085087 |
| Molecular Formula | C18H14BrNO4 |
| Molecular Weight | 388.22 g/mol |
| Exact Mass | 387.01 |
| IUPAC Name | (2-phenyl-1,3-oxazol-4-yl)methyl 2-bromo-5-methoxybenzoate |
| SMILES | COc1ccc(Br)c(C(=O)OCc2coc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C18H14BrNO4/c1-22-14-7-8-16(19)15(9-14)18(21)24-11-13-10-23-17(20-13)12-5-3-2-4-6-12/h2-10H,11H2,1H3 |
| InChIKey | WLTDLQHTVWJZOK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.22 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |