C11H10FNO2 — CID 117190932
4-[(2-fluorophenoxy)methyl]-2-methyl-1,3-oxazole (PubChem CID 117190932) has the molecular formula C11H10FNO2 and a molecular weight of 207.20 g/mol. Its IUPAC name is 4-[(2-fluorophenoxy)methyl]-2-methyl-1,3-oxazole.
| Compound Name | 4-[(2-fluorophenoxy)methyl]-2-methyl-1,3-oxazole |
|---|---|
| PubChem CID | 117190932 |
| Molecular Formula | C11H10FNO2 |
| Molecular Weight | 207.20 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 4-[(2-fluorophenoxy)methyl]-2-methyl-1,3-oxazole |
| SMILES | Cc1nc(COc2ccccc2F)co1 |
| InChI | InChI=1S/C11H10FNO2/c1-8-13-9(6-14-8)7-15-11-5-3-2-4-10(11)12/h2-6H,7H2,1H3 |
| InChIKey | OXZYMMKOVXPHDC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.20 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |