C11H12N2O3 — CID 117190945
4-[(2-methoxyphenoxy)methyl]-1,3-oxazol-2-amine (PubChem CID 117190945) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is 4-[(2-methoxyphenoxy)methyl]-1,3-oxazol-2-amine.
| Compound Name | 4-[(2-methoxyphenoxy)methyl]-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 117190945 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 4-[(2-methoxyphenoxy)methyl]-1,3-oxazol-2-amine |
| SMILES | COc1ccccc1OCc1coc(N)n1 |
| InChI | InChI=1S/C11H12N2O3/c1-14-9-4-2-3-5-10(9)15-6-8-7-16-11(12)13-8/h2-5,7H,6H2,1H3,(H2,12,13) |
| InChIKey | GXDXRIGQEOLZFR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |