C13H16ClN3O2 — CID 3051324
2-[(2-methoxyphenoxy)methyl]-6-methylpyrimidin-4-amine;hydrochloride (PubChem CID 3051324) has the molecular formula C13H16ClN3O2 and a molecular weight of 281.74 g/mol. Its IUPAC name is 2-[(2-methoxyphenoxy)methyl]-6-methylpyrimidin-4-amine;hydrochloride.
| Compound Name | 2-[(2-methoxyphenoxy)methyl]-6-methylpyrimidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 3051324 |
| Molecular Formula | C13H16ClN3O2 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 2-[(2-methoxyphenoxy)methyl]-6-methylpyrimidin-4-amine;hydrochloride |
| SMILES | COc1ccccc1OCc1nc(C)cc(N)n1.Cl |
| InChI | InChI=1S/C13H15N3O2.ClH/c1-9-7-12(14)16-13(15-9)8-18-11-6-4-3-5-10(11)17-2;/h3-7H,8H2,1-2H3,(H2,14,15,16);1H |
| InChIKey | JHIVLPNRCVFJIK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |