C11H12N2O2S — CID 117214469
5-[(2-methoxyphenoxy)methyl]-1,3-thiazol-4-amine (PubChem CID 117214469) has the molecular formula C11H12N2O2S and a molecular weight of 236.30 g/mol. Its IUPAC name is 5-[(2-methoxyphenoxy)methyl]-1,3-thiazol-4-amine.
| Compound Name | 5-[(2-methoxyphenoxy)methyl]-1,3-thiazol-4-amine |
|---|---|
| PubChem CID | 117214469 |
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 5-[(2-methoxyphenoxy)methyl]-1,3-thiazol-4-amine |
| SMILES | COc1ccccc1OCc1scnc1N |
| InChI | InChI=1S/C11H12N2O2S/c1-14-8-4-2-3-5-9(8)15-6-10-11(12)13-7-16-10/h2-5,7H,6,12H2,1H3 |
| InChIKey | WJSHDRGHRZTLJA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |