C20H18FN3O4S — CID 9323740
N'-[2-(2-fluorophenoxy)acetyl]-4-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzohydrazide (PubChem CID 9323740) has the molecular formula C20H18FN3O4S and a molecular weight of 415.45 g/mol. Its IUPAC name is N'-[2-(2-fluorophenoxy)acetyl]-4-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzohydrazide.
| Compound Name | N'-[2-(2-fluorophenoxy)acetyl]-4-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzohydrazide |
|---|---|
| PubChem CID | 9323740 |
| Molecular Formula | C20H18FN3O4S |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | N'-[2-(2-fluorophenoxy)acetyl]-4-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzohydrazide |
| SMILES | Cc1nc(COc2ccc(C(=O)NNC(=O)COc3ccccc3F)cc2)cs1 |
| InChI | InChI=1S/C20H18FN3O4S/c1-13-22-15(12-29-13)10-27-16-8-6-14(7-9-16)20(26)24-23-19(25)11-28-18-5-3-2-4-17(18)21/h2-9,12H,10-11H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | BODZXEWBMFYVNW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|