C17H22ClNOS — CID 107667094
2-[3-(4-butan-2-ylphenoxy)propyl]-4-(chloromethyl)-1,3-thiazole (PubChem CID 107667094) has the molecular formula C17H22ClNOS and a molecular weight of 323.89 g/mol. Its IUPAC name is 2-[3-(4-butan-2-ylphenoxy)propyl]-4-(chloromethyl)-1,3-thiazole.
| Compound Name | 2-[3-(4-butan-2-ylphenoxy)propyl]-4-(chloromethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 107667094 |
| Molecular Formula | C17H22ClNOS |
| Molecular Weight | 323.89 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 2-[3-(4-butan-2-ylphenoxy)propyl]-4-(chloromethyl)-1,3-thiazole |
| SMILES | CCC(C)c1ccc(OCCCc2nc(CCl)cs2)cc1 |
| InChI | InChI=1S/C17H22ClNOS/c1-3-13(2)14-6-8-16(9-7-14)20-10-4-5-17-19-15(11-18)12-21-17/h6-9,12-13H,3-5,10-11H2,1-2H3 |
| InChIKey | FEGJNCPYFCNMNK-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.89 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|