C16H21ClN2S — CID 65486866
3-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-methyl-N-(2-phenylethyl)propan-1-amine (PubChem CID 65486866) has the molecular formula C16H21ClN2S and a molecular weight of 308.88 g/mol. Its IUPAC name is 3-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-methyl-N-(2-phenylethyl)propan-1-amine.
| Compound Name | 3-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-methyl-N-(2-phenylethyl)propan-1-amine |
|---|---|
| PubChem CID | 65486866 |
| Molecular Formula | C16H21ClN2S |
| Molecular Weight | 308.88 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 3-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-methyl-N-(2-phenylethyl)propan-1-amine |
| SMILES | CN(CCCc1nc(CCl)cs1)CCc1ccccc1 |
| InChI | InChI=1S/C16H21ClN2S/c1-19(11-9-14-6-3-2-4-7-14)10-5-8-16-18-15(12-17)13-20-16/h2-4,6-7,13H,5,8-12H2,1H3 |
| InChIKey | RUGBQSAPZUBTMM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.88 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|