C12H19BrN2 — CID 61420148
N'-[(2-bromophenyl)methyl]-N,N'-dimethylpropane-1,3-diamine (PubChem CID 61420148) has the molecular formula C12H19BrN2 and a molecular weight of 271.20 g/mol. Its IUPAC name is N'-[(2-bromophenyl)methyl]-N,N'-dimethylpropane-1,3-diamine.
| Compound Name | N'-[(2-bromophenyl)methyl]-N,N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 61420148 |
| Molecular Formula | C12H19BrN2 |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | N'-[(2-bromophenyl)methyl]-N,N'-dimethylpropane-1,3-diamine |
| SMILES | CNCCCN(C)Cc1ccccc1Br |
| InChI | InChI=1S/C12H19BrN2/c1-14-8-5-9-15(2)10-11-6-3-4-7-12(11)13/h3-4,6-7,14H,5,8-10H2,1-2H3 |
| InChIKey | VSGSCSKSUJSSLA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|