C14H23BrN2 — CID 61420007
N'-[(2-bromophenyl)methyl]-N'-methylhexane-1,6-diamine (PubChem CID 61420007) has the molecular formula C14H23BrN2 and a molecular weight of 299.26 g/mol. Its IUPAC name is N'-[(2-bromophenyl)methyl]-N'-methylhexane-1,6-diamine.
| Compound Name | N'-[(2-bromophenyl)methyl]-N'-methylhexane-1,6-diamine |
|---|---|
| PubChem CID | 61420007 |
| Molecular Formula | C14H23BrN2 |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | N'-[(2-bromophenyl)methyl]-N'-methylhexane-1,6-diamine |
| SMILES | CN(CCCCCCN)Cc1ccccc1Br |
| InChI | InChI=1S/C14H23BrN2/c1-17(11-7-3-2-6-10-16)12-13-8-4-5-9-14(13)15/h4-5,8-9H,2-3,6-7,10-12,16H2,1H3 |
| InChIKey | IAQNYLBDPYCFHI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|