C14H22N4S — CID 55144234
N'-methyl-N'-[(1-methylimidazol-2-yl)methyl]-N-(2-thiophen-2-ylethyl)ethane-1,2-diamine (PubChem CID 55144234) has the molecular formula C14H22N4S and a molecular weight of 278.42 g/mol. Its IUPAC name is N'-methyl-N'-[(1-methylimidazol-2-yl)methyl]-N-(2-thiophen-2-ylethyl)ethane-1,2-diamine.
| Compound Name | N'-methyl-N'-[(1-methylimidazol-2-yl)methyl]-N-(2-thiophen-2-ylethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 55144234 |
| Molecular Formula | C14H22N4S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | N'-methyl-N'-[(1-methylimidazol-2-yl)methyl]-N-(2-thiophen-2-ylethyl)ethane-1,2-diamine |
| SMILES | CN(CCNCCc1cccs1)Cc1nccn1C |
| InChI | InChI=1S/C14H22N4S/c1-17(12-14-16-8-10-18(14)2)9-7-15-6-5-13-4-3-11-19-13/h3-4,8,10-11,15H,5-7,9,12H2,1-2H3 |
| InChIKey | ZJXNGPITFFNUIU-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|