C14H12F2OS — CID 55236513
1-(3,5-difluorophenyl)-4-thiophen-2-ylbutan-2-one (PubChem CID 55236513) has the molecular formula C14H12F2OS and a molecular weight of 266.31 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)-4-thiophen-2-ylbutan-2-one.
| Compound Name | 1-(3,5-difluorophenyl)-4-thiophen-2-ylbutan-2-one |
|---|---|
| PubChem CID | 55236513 |
| Molecular Formula | C14H12F2OS |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 1-(3,5-difluorophenyl)-4-thiophen-2-ylbutan-2-one |
| SMILES | O=C(CCc1cccs1)Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C14H12F2OS/c15-11-6-10(7-12(16)9-11)8-13(17)3-4-14-2-1-5-18-14/h1-2,5-7,9H,3-4,8H2 |
| InChIKey | QBOHJTFZCSWODP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |