C13H17NS2 — CID 65244071
N-[(4,5-dimethylthiophen-2-yl)methyl]-2-thiophen-2-ylethanamine (PubChem CID 65244071) has the molecular formula C13H17NS2 and a molecular weight of 251.42 g/mol. Its IUPAC name is N-[(4,5-dimethylthiophen-2-yl)methyl]-2-thiophen-2-ylethanamine.
| Compound Name | N-[(4,5-dimethylthiophen-2-yl)methyl]-2-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 65244071 |
| Molecular Formula | C13H17NS2 |
| Molecular Weight | 251.42 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | N-[(4,5-dimethylthiophen-2-yl)methyl]-2-thiophen-2-ylethanamine |
| SMILES | Cc1cc(CNCCc2cccs2)sc1C |
| InChI | InChI=1S/C13H17NS2/c1-10-8-13(16-11(10)2)9-14-6-5-12-4-3-7-15-12/h3-4,7-8,14H,5-6,9H2,1-2H3 |
| InChIKey | VIGNIFKFRAULGP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|