C18H22S — CID 70351967
2-(8-phenyloct-4-enyl)thiophene (PubChem CID 70351967) has the molecular formula C18H22S and a molecular weight of 270.44 g/mol. Its IUPAC name is 2-(8-phenyloct-4-enyl)thiophene.
| Compound Name | 2-(8-phenyloct-4-enyl)thiophene |
|---|---|
| PubChem CID | 70351967 |
| Molecular Formula | C18H22S |
| Molecular Weight | 270.44 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 2-(8-phenyloct-4-enyl)thiophene |
| SMILES | C(=CCCCc1cccs1)CCCc1ccccc1 |
| InChI | InChI=1S/C18H22S/c1(2-4-9-14-18-15-10-16-19-18)3-6-11-17-12-7-5-8-13-17/h1-2,5,7-8,10,12-13,15-16H,3-4,6,9,11,14H2 |
| InChIKey | PFIPTAHPOLTKIO-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.44 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|