C12H21N3S — CID 63824137
3-piperidin-3-yl-N-(1,3-thiazol-4-ylmethyl)propan-1-amine (PubChem CID 63824137) has the molecular formula C12H21N3S and a molecular weight of 239.39 g/mol. Its IUPAC name is 3-piperidin-3-yl-N-(1,3-thiazol-4-ylmethyl)propan-1-amine.
| Compound Name | 3-piperidin-3-yl-N-(1,3-thiazol-4-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 63824137 |
| Molecular Formula | C12H21N3S |
| Molecular Weight | 239.39 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 3-piperidin-3-yl-N-(1,3-thiazol-4-ylmethyl)propan-1-amine |
| SMILES | c1nc(CNCCCC2CCCNC2)cs1 |
| InChI | InChI=1S/C12H21N3S/c1-3-11(7-13-5-1)4-2-6-14-8-12-9-16-10-15-12/h9-11,13-14H,1-8H2 |
| InChIKey | SKIAJHNFQZMGIZ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|