C10H20F2N2 — CID 115407510
N-(2,2-difluoroethyl)-3-piperidin-3-ylpropan-1-amine (PubChem CID 115407510) has the molecular formula C10H20F2N2 and a molecular weight of 206.28 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-3-piperidin-3-ylpropan-1-amine.
| Compound Name | N-(2,2-difluoroethyl)-3-piperidin-3-ylpropan-1-amine |
|---|---|
| PubChem CID | 115407510 |
| Molecular Formula | C10H20F2N2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.16 |
| IUPAC Name | N-(2,2-difluoroethyl)-3-piperidin-3-ylpropan-1-amine |
| SMILES | FC(F)CNCCCC1CCCNC1 |
| InChI | InChI=1S/C10H20F2N2/c11-10(12)8-14-6-2-4-9-3-1-5-13-7-9/h9-10,13-14H,1-8H2 |
| InChIKey | FREVHHATJDJXHH-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|