C13H28N2O2 — CID 114100547
2,3-dimethoxy-N-(3-piperidin-3-ylpropyl)propan-1-amine (PubChem CID 114100547) has the molecular formula C13H28N2O2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 2,3-dimethoxy-N-(3-piperidin-3-ylpropyl)propan-1-amine.
| Compound Name | 2,3-dimethoxy-N-(3-piperidin-3-ylpropyl)propan-1-amine |
|---|---|
| PubChem CID | 114100547 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | 2,3-dimethoxy-N-(3-piperidin-3-ylpropyl)propan-1-amine |
| SMILES | COCC(CNCCCC1CCCNC1)OC |
| InChI | InChI=1S/C13H28N2O2/c1-16-11-13(17-2)10-15-8-4-6-12-5-3-7-14-9-12/h12-15H,3-11H2,1-2H3 |
| InChIKey | AOOFAGKDFPDFTC-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|