C10H22N2O2 — CID 80555810
2,2-dimethoxy-N-(piperidin-3-ylmethyl)ethanamine (PubChem CID 80555810) has the molecular formula C10H22N2O2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 2,2-dimethoxy-N-(piperidin-3-ylmethyl)ethanamine.
| Compound Name | 2,2-dimethoxy-N-(piperidin-3-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 80555810 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 2,2-dimethoxy-N-(piperidin-3-ylmethyl)ethanamine |
| SMILES | COC(CNCC1CCCNC1)OC |
| InChI | InChI=1S/C10H22N2O2/c1-13-10(14-2)8-12-7-9-4-3-5-11-6-9/h9-12H,3-8H2,1-2H3 |
| InChIKey | PAFZPUZITABYTB-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|