C10H21NO2S — CID 112704412
2,2-dimethoxy-N-(thian-4-ylmethyl)ethanamine (PubChem CID 112704412) has the molecular formula C10H21NO2S and a molecular weight of 219.35 g/mol. Its IUPAC name is 2,2-dimethoxy-N-(thian-4-ylmethyl)ethanamine.
| Compound Name | 2,2-dimethoxy-N-(thian-4-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 112704412 |
| Molecular Formula | C10H21NO2S |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 2,2-dimethoxy-N-(thian-4-ylmethyl)ethanamine |
| SMILES | COC(CNCC1CCSCC1)OC |
| InChI | InChI=1S/C10H21NO2S/c1-12-10(13-2)8-11-7-9-3-5-14-6-4-9/h9-11H,3-8H2,1-2H3 |
| InChIKey | GMTHWALGCCCPRC-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|