C8H17NO2S — CID 60663265
N-(2,2-dimethoxyethyl)thiolan-3-amine (PubChem CID 60663265) has the molecular formula C8H17NO2S and a molecular weight of 191.30 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)thiolan-3-amine.
| Compound Name | N-(2,2-dimethoxyethyl)thiolan-3-amine |
|---|---|
| PubChem CID | 60663265 |
| Molecular Formula | C8H17NO2S |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.10 |
| IUPAC Name | N-(2,2-dimethoxyethyl)thiolan-3-amine |
| SMILES | COC(CNC1CCSC1)OC |
| InChI | InChI=1S/C8H17NO2S/c1-10-8(11-2)5-9-7-3-4-12-6-7/h7-9H,3-6H2,1-2H3 |
| InChIKey | PTVPIZAGBRQYRM-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|