C9H18F2N2 — CID 115407412
2,2-difluoro-N-(2-piperidin-4-ylethyl)ethanamine (PubChem CID 115407412) has the molecular formula C9H18F2N2 and a molecular weight of 192.25 g/mol. Its IUPAC name is 2,2-difluoro-N-(2-piperidin-4-ylethyl)ethanamine.
| Compound Name | 2,2-difluoro-N-(2-piperidin-4-ylethyl)ethanamine |
|---|---|
| PubChem CID | 115407412 |
| Molecular Formula | C9H18F2N2 |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 2,2-difluoro-N-(2-piperidin-4-ylethyl)ethanamine |
| SMILES | FC(F)CNCCC1CCNCC1 |
| InChI | InChI=1S/C9H18F2N2/c10-9(11)7-13-6-3-8-1-4-12-5-2-8/h8-9,12-13H,1-7H2 |
| InChIKey | XROQCLXAQDOGBI-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|