C8H16F2N2 — CID 84656479
N-(2,2-difluoroethyl)azepan-4-amine (PubChem CID 84656479) has the molecular formula C8H16F2N2 and a molecular weight of 178.23 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)azepan-4-amine.
| Compound Name | N-(2,2-difluoroethyl)azepan-4-amine |
|---|---|
| PubChem CID | 84656479 |
| Molecular Formula | C8H16F2N2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.13 |
| IUPAC Name | N-(2,2-difluoroethyl)azepan-4-amine |
| SMILES | FC(F)CNC1CCCNCC1 |
| InChI | InChI=1S/C8H16F2N2/c9-8(10)6-12-7-2-1-4-11-5-3-7/h7-8,11-12H,1-6H2 |
| InChIKey | CCALTUMCQUWCHH-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |