About piperazine;4-(3-piperidin-4-ylpropyl)piperidine
piperazine;4-(3-piperidin-4-ylpropyl)piperidine (PubChem CID 143744833) has the molecular formula C17H36N4
and a molecular weight of 296.50 g/mol. Its IUPAC name is piperazine;4-(3-piperidin-4-ylpropyl)piperidine.
Molecular Properties
| Compound Name | piperazine;4-(3-piperidin-4-ylpropyl)piperidine |
| PubChem CID | 143744833 |
| Molecular Formula | C17H36N4 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.29 |
| IUPAC Name | piperazine;4-(3-piperidin-4-ylpropyl)piperidine |
| SMILES | C(CC1CCNCC1)CC1CCNCC1.C1CNCCN1 |
| InChI | InChI=1S/C13H26N2.C4H10N2/c1(2-12-4-8-14-9-5-12)3-13-6-10-15-11-7-13;1-2-6-4-3-5-1/h12-15H,1-11H2;5-6H,1-4H2 |
| InChIKey | HQSXVDPOFCQVHT-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze piperazine;4-(3-piperidin-4-ylpropyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperazine;4-(3-piperidin-4-ylpropyl)piperidine?
The IUPAC name of piperazine;4-(3-piperidin-4-ylpropyl)piperidine (CID 143744833) is piperazine;4-(3-piperidin-4-ylpropyl)piperidine.
What is the SMILES notation for piperazine;4-(3-piperidin-4-ylpropyl)piperidine?
The canonical SMILES for piperazine;4-(3-piperidin-4-ylpropyl)piperidine is C(CC1CCNCC1)CC1CCNCC1.C1CNCCN1.
What is the InChIKey of piperazine;4-(3-piperidin-4-ylpropyl)piperidine?
The InChIKey is HQSXVDPOFCQVHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2.C4H10N2/c1(2-12-4-8-14-9-5-12)3-13-6-10-15-11-7-13;1-2-6-4-3-5-1/h12-15H,1-11H2;5-6H,1-4H2.
What are the key properties of piperazine;4-(3-piperidin-4-ylpropyl)piperidine?
piperazine;4-(3-piperidin-4-ylpropyl)piperidine has a molecular weight of 296.50 g/mol, XLogP of 1.34, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperazine;4-(3-piperidin-4-ylpropyl)piperidine is sourced from PubChem (CID 143744833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).