C15H30N2O5 — CID 139982732
2-[4-(3-piperidin-4-ylpropyl)piperidin-1-yl]ethane-1,1,1,2,2-pentol (PubChem CID 139982732) has the molecular formula C15H30N2O5 and a molecular weight of 318.41 g/mol. Its IUPAC name is 2-[4-(3-piperidin-4-ylpropyl)piperidin-1-yl]ethane-1,1,1,2,2-pentol.
| Compound Name | 2-[4-(3-piperidin-4-ylpropyl)piperidin-1-yl]ethane-1,1,1,2,2-pentol |
|---|---|
| PubChem CID | 139982732 |
| Molecular Formula | C15H30N2O5 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | 2-[4-(3-piperidin-4-ylpropyl)piperidin-1-yl]ethane-1,1,1,2,2-pentol |
| SMILES | OC(O)(O)C(O)(O)N1CCC(CCCC2CCNCC2)CC1 |
| InChI | InChI=1S/C15H30N2O5/c18-14(19,15(20,21)22)17-10-6-13(7-11-17)3-1-2-12-4-8-16-9-5-12/h12-13,16,18-22H,1-11H2 |
| InChIKey | AURRCLKOKNHGBU-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 116.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|