C12H20ClN2O3S2- — CID 53314568
2,5-dimethyl-N-(2-morpholin-4-ylethyl)thiophene-3-sulfonamide chloride (PubChem CID 53314568) has the molecular formula C12H20ClN2O3S2- and a molecular weight of 339.89 g/mol. Its IUPAC name is 2,5-dimethyl-N-(2-morpholin-4-ylethyl)thiophene-3-sulfonamide chloride.
| Compound Name | 2,5-dimethyl-N-(2-morpholin-4-ylethyl)thiophene-3-sulfonamide chloride |
|---|---|
| PubChem CID | 53314568 |
| Molecular Formula | C12H20ClN2O3S2- |
| Molecular Weight | 339.89 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 2,5-dimethyl-N-(2-morpholin-4-ylethyl)thiophene-3-sulfonamide chloride |
| SMILES | Cc1cc(S(=O)(=O)NCCN2CCOCC2)c(C)s1.[Cl-] |
| InChI | InChI=1S/C12H20N2O3S2.ClH/c1-10-9-12(11(2)18-10)19(15,16)13-3-4-14-5-7-17-8-6-14;/h9,13H,3-8H2,1-2H3;1H/p-1 |
| InChIKey | VDRNUBKZENJLRN-UHFFFAOYSA-M |
| XLogP | -2.02 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.89 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |