C14H20N4O3S2 — CID 20947489
5-(5-methyl-1H-pyrazol-3-yl)-N-(2-morpholin-4-ylethyl)thiophene-2-sulfonamide (PubChem CID 20947489) has the molecular formula C14H20N4O3S2 and a molecular weight of 356.47 g/mol. Its IUPAC name is 5-(5-methyl-1H-pyrazol-3-yl)-N-(2-morpholin-4-ylethyl)thiophene-2-sulfonamide.
| Compound Name | 5-(5-methyl-1H-pyrazol-3-yl)-N-(2-morpholin-4-ylethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 20947489 |
| Molecular Formula | C14H20N4O3S2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 5-(5-methyl-1H-pyrazol-3-yl)-N-(2-morpholin-4-ylethyl)thiophene-2-sulfonamide |
| SMILES | Cc1cc(-c2ccc(S(=O)(=O)NCCN3CCOCC3)s2)n[nH]1 |
| InChI | InChI=1S/C14H20N4O3S2/c1-11-10-12(17-16-11)13-2-3-14(22-13)23(19,20)15-4-5-18-6-8-21-9-7-18/h2-3,10,15H,4-9H2,1H3,(H,16,17) |
| InChIKey | YWWKOLFSTRYADY-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |