C10H19N5O3S — CID 63977723
5-amino-3-methyl-N-(2-morpholin-4-ylethyl)imidazole-4-sulfonamide (PubChem CID 63977723) has the molecular formula C10H19N5O3S and a molecular weight of 289.36 g/mol. Its IUPAC name is 5-amino-3-methyl-N-(2-morpholin-4-ylethyl)imidazole-4-sulfonamide.
| Compound Name | 5-amino-3-methyl-N-(2-morpholin-4-ylethyl)imidazole-4-sulfonamide |
|---|---|
| PubChem CID | 63977723 |
| Molecular Formula | C10H19N5O3S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 5-amino-3-methyl-N-(2-morpholin-4-ylethyl)imidazole-4-sulfonamide |
| SMILES | Cn1cnc(N)c1S(=O)(=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C10H19N5O3S/c1-14-8-12-9(11)10(14)19(16,17)13-2-3-15-4-6-18-7-5-15/h8,13H,2-7,11H2,1H3 |
| InChIKey | AZSBZJIWYSAVIO-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |