C7H14N4O3S — CID 107212641
5-amino-N-[(2S)-1-hydroxypropan-2-yl]-3-methylimidazole-4-sulfonamide (PubChem CID 107212641) has the molecular formula C7H14N4O3S and a molecular weight of 234.28 g/mol. Its IUPAC name is 5-amino-N-[(2S)-1-hydroxypropan-2-yl]-3-methylimidazole-4-sulfonamide.
| Compound Name | 5-amino-N-[(2S)-1-hydroxypropan-2-yl]-3-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 107212641 |
| Molecular Formula | C7H14N4O3S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 5-amino-N-[(2S)-1-hydroxypropan-2-yl]-3-methylimidazole-4-sulfonamide |
| SMILES | C[C@@H](CO)NS(=O)(=O)c1c(N)ncn1C |
| InChI | InChI=1S/C7H14N4O3S/c1-5(3-12)10-15(13,14)7-6(8)9-4-11(7)2/h4-5,10,12H,3,8H2,1-2H3/t5-/m0/s1 |
| InChIKey | VJDDGIFDDIUCBH-YFKPBYRVSA-N |
| XLogP | -1.34 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |